![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| ACADEMICCALENDAR24-25.pdf | 2025-02-10 10:51 | 2.3M | |
| Noobjectioncertificate.pdf | 2025-02-10 10:51 | 794K | |
| PTA committee.pdf | 2025-02-10 10:51 | 367K | |
| RTEcertificate.pdf | 2025-02-10 10:51 | 505K | |
| TPSAdmissionForm.pdf | 2025-02-10 10:51 | 519K | |
| TPS Admission Form.pdf_Old_4Dec2015.pdf | 2025-02-10 10:51 | 1.4M | |
| TPS Fee Structure.pdf | 2025-02-10 10:51 | 136K | |
| TPS Prospectus.pdf | 2025-02-10 10:51 | 1.8M | |
| TPS Prospectus.pdf_Old_4Dec2015.pdf | 2025-02-10 10:51 | 1.7M | |
| TYPSyllabus.pdf | 2025-02-10 10:51 | 1.9M | |
| building construction certificate.pdf | 2025-02-10 10:51 | 259K | |
| details of school campus building and playground.pdf | 2025-02-10 10:51 | 187K | |
| detailsoftoiletandwatertapsavailable.pdf | 2025-02-10 10:51 | 232K | |
| drinking water and sanitary certificate.pdf | 2025-02-10 10:51 | 252K | |
| fee structure.pdf | 2025-02-10 10:51 | 63K | |
| fire safety certificate.pdf | 2025-02-10 10:51 | 97K | |
| school committee.pdf | 2025-02-10 10:51 | 308K | |